C12H11NO4 — CID 132915513
4,6-dimethoxy-1H-indole-2,7-dicarbaldehyde (PubChem CID 132915513) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 4,6-dimethoxy-1H-indole-2,7-dicarbaldehyde.
| Compound Name | 4,6-dimethoxy-1H-indole-2,7-dicarbaldehyde |
|---|---|
| PubChem CID | 132915513 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 4,6-dimethoxy-1H-indole-2,7-dicarbaldehyde |
| SMILES | COc1cc(OC)c2cc(C=O)[nH]c2c1C=O |
| InChI | InChI=1S/C12H11NO4/c1-16-10-4-11(17-2)9(6-15)12-8(10)3-7(5-14)13-12/h3-6,13H,1-2H3 |
| InChIKey | NWKAKDSWAOMUBT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|