C11H9BrFNO3 — CID 58004725
2-bromo-6-fluoro-5,7-dimethoxy-1H-indole-3-carbaldehyde (PubChem CID 58004725) has the molecular formula C11H9BrFNO3 and a molecular weight of 302.10 g/mol. Its IUPAC name is 2-bromo-6-fluoro-5,7-dimethoxy-1H-indole-3-carbaldehyde.
| Compound Name | 2-bromo-6-fluoro-5,7-dimethoxy-1H-indole-3-carbaldehyde |
|---|---|
| PubChem CID | 58004725 |
| Molecular Formula | C11H9BrFNO3 |
| Molecular Weight | 302.10 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | 2-bromo-6-fluoro-5,7-dimethoxy-1H-indole-3-carbaldehyde |
| SMILES | COc1cc2c(C=O)c(Br)[nH]c2c(OC)c1F |
| InChI | InChI=1S/C11H9BrFNO3/c1-16-7-3-5-6(4-15)11(12)14-9(5)10(17-2)8(7)13/h3-4,14H,1-2H3 |
| InChIKey | UHKZOZGEEMVPPM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.10 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|