C11H10O4 — CID 82396117
4,6-dimethoxy-1-benzofuran-7-carbaldehyde (PubChem CID 82396117) has the molecular formula C11H10O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is 4,6-dimethoxy-1-benzofuran-7-carbaldehyde.
| Compound Name | 4,6-dimethoxy-1-benzofuran-7-carbaldehyde |
|---|---|
| PubChem CID | 82396117 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 4,6-dimethoxy-1-benzofuran-7-carbaldehyde |
| SMILES | COc1cc(OC)c2ccoc2c1C=O |
| InChI | InChI=1S/C11H10O4/c1-13-9-5-10(14-2)8(6-12)11-7(9)3-4-15-11/h3-6H,1-2H3 |
| InChIKey | VDTVZSPQNVASIS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|