C14H14O6 — CID 134924711
ethyl 7-formyl-4,6-dimethoxy-1-benzofuran-2-carboxylate (PubChem CID 134924711) has the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. Its IUPAC name is ethyl 7-formyl-4,6-dimethoxy-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 7-formyl-4,6-dimethoxy-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 134924711 |
| Molecular Formula | C14H14O6 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | ethyl 7-formyl-4,6-dimethoxy-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(OC)cc(OC)c(C=O)c2o1 |
| InChI | InChI=1S/C14H14O6/c1-4-19-14(16)12-5-8-10(17-2)6-11(18-3)9(7-15)13(8)20-12/h5-7H,4H2,1-3H3 |
| InChIKey | MXQLRRZMZANIEK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|