C15H12O6 — CID 101182137
4,9-dimethoxy-7-methyl-5-oxofuro[3,2-g]chromene-6-carbaldehyde (PubChem CID 101182137) has the molecular formula C15H12O6 and a molecular weight of 288.25 g/mol. Its IUPAC name is 4,9-dimethoxy-7-methyl-5-oxofuro[3,2-g]chromene-6-carbaldehyde.
| Compound Name | 4,9-dimethoxy-7-methyl-5-oxofuro[3,2-g]chromene-6-carbaldehyde |
|---|---|
| PubChem CID | 101182137 |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 4,9-dimethoxy-7-methyl-5-oxofuro[3,2-g]chromene-6-carbaldehyde |
| SMILES | COc1c2occc2c(OC)c2c(=O)c(C=O)c(C)oc12 |
| InChI | InChI=1S/C15H12O6/c1-7-9(6-16)11(17)10-12(18-2)8-4-5-20-13(8)15(19-3)14(10)21-7/h4-6H,1-3H3 |
| InChIKey | XBVGMVWFMWKXRJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|