C16H14O8 — CID 10830529
(4,9-dimethoxy-7-oxofuro[3,2-g]chromen-5-yl) ethyl carbonate (PubChem CID 10830529) has the molecular formula C16H14O8 and a molecular weight of 334.28 g/mol. Its IUPAC name is (4,9-dimethoxy-7-oxofuro[3,2-g]chromen-5-yl) ethyl carbonate.
| Compound Name | (4,9-dimethoxy-7-oxofuro[3,2-g]chromen-5-yl) ethyl carbonate |
|---|---|
| PubChem CID | 10830529 |
| Molecular Formula | C16H14O8 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | (4,9-dimethoxy-7-oxofuro[3,2-g]chromen-5-yl) ethyl carbonate |
| SMILES | CCOC(=O)Oc1cc(=O)oc2c(OC)c3occc3c(OC)c12 |
| InChI | InChI=1S/C16H14O8/c1-4-21-16(18)23-9-7-10(17)24-14-11(9)12(19-2)8-5-6-22-13(8)15(14)20-3/h5-7H,4H2,1-3H3 |
| InChIKey | HNSZERICKQMMFT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 97.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|