C12H10ClNO4 — CID 3717056
2-chloro-5,7-dimethoxy-1H-indole-3,4-dicarbaldehyde (PubChem CID 3717056) has the molecular formula C12H10ClNO4 and a molecular weight of 267.67 g/mol. Its IUPAC name is 2-chloro-5,7-dimethoxy-1H-indole-3,4-dicarbaldehyde.
| Compound Name | 2-chloro-5,7-dimethoxy-1H-indole-3,4-dicarbaldehyde |
|---|---|
| PubChem CID | 3717056 |
| Molecular Formula | C12H10ClNO4 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 2-chloro-5,7-dimethoxy-1H-indole-3,4-dicarbaldehyde |
| SMILES | COc1cc(OC)c2[nH]c(Cl)c(C=O)c2c1C=O |
| InChI | InChI=1S/C12H10ClNO4/c1-17-8-3-9(18-2)11-10(6(8)4-15)7(5-16)12(13)14-11/h3-5,14H,1-2H3 |
| InChIKey | MLPMMQAGFLIJPY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|