C8H7NO3 — CID 96633557
3-methoxy-6H-furo[2,3-b]pyrrole-5-carbaldehyde (PubChem CID 96633557) has the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. Its IUPAC name is 3-methoxy-6H-furo[2,3-b]pyrrole-5-carbaldehyde.
| Compound Name | 3-methoxy-6H-furo[2,3-b]pyrrole-5-carbaldehyde |
|---|---|
| PubChem CID | 96633557 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 3-methoxy-6H-furo[2,3-b]pyrrole-5-carbaldehyde |
| SMILES | COc1coc2[nH]c(C=O)cc12 |
| InChI | InChI=1S/C8H7NO3/c1-11-7-4-12-8-6(7)2-5(3-10)9-8/h2-4,9H,1H3 |
| InChIKey | AEEGFSPFGMQYAH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|