C11H10O4 — CID 131462840
6,7-dimethoxy-1-benzofuran-3-carbaldehyde (PubChem CID 131462840) has the molecular formula C11H10O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is 6,7-dimethoxy-1-benzofuran-3-carbaldehyde.
| Compound Name | 6,7-dimethoxy-1-benzofuran-3-carbaldehyde |
|---|---|
| PubChem CID | 131462840 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 6,7-dimethoxy-1-benzofuran-3-carbaldehyde |
| SMILES | COc1ccc2c(C=O)coc2c1OC |
| InChI | InChI=1S/C11H10O4/c1-13-9-4-3-8-7(5-12)6-15-10(8)11(9)14-2/h3-6H,1-2H3 |
| InChIKey | MTLZBSXVOZFYCZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|