C19H17BO4 — CID 170734664
CID 170734664 (PubChem CID 170734664) has the molecular formula C19H17BO4 and a molecular weight of 320.15 g/mol.
| Compound Name | CID 170734664 |
|---|---|
| PubChem CID | 170734664 |
| Molecular Formula | C19H17BO4 |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | — |
| SMILES | [B]CCc1ccc(-c2coc3c(OC)c(OC)ccc3c2=O)cc1 |
| InChI | InChI=1S/C19H17BO4/c1-22-16-8-7-14-17(21)15(11-24-18(14)19(16)23-2)13-5-3-12(4-6-13)9-10-20/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | QYFXQQYKCLOYBD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|