C19H16O7 — CID 54135854
2-[4-(7,8-dimethoxy-4-oxochromen-3-yl)phenoxy]acetic acid (PubChem CID 54135854) has the molecular formula C19H16O7 and a molecular weight of 356.33 g/mol. Its IUPAC name is 2-[4-(7,8-dimethoxy-4-oxochromen-3-yl)phenoxy]acetic acid.
| Compound Name | 2-[4-(7,8-dimethoxy-4-oxochromen-3-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 54135854 |
| Molecular Formula | C19H16O7 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 2-[4-(7,8-dimethoxy-4-oxochromen-3-yl)phenoxy]acetic acid |
| SMILES | COc1ccc2c(=O)c(-c3ccc(OCC(=O)O)cc3)coc2c1OC |
| InChI | InChI=1S/C19H16O7/c1-23-15-8-7-13-17(22)14(9-26-18(13)19(15)24-2)11-3-5-12(6-4-11)25-10-16(20)21/h3-9H,10H2,1-2H3,(H,20,21) |
| InChIKey | NXQGNIDMIJDGOB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |