2-[4-(7,8-dimethoxy-4-oxochromen-3-yl)phenoxy]acetic acid

C19H16O7 — CID 54135854

IUPAC2-[4-(7,8-dimethoxy-4-oxochromen-3-yl)phenoxy]acetic acid
SMILESCOc1ccc2c(=O)c(-c3ccc(OCC(=O)O)cc3)coc2c1OC
InChIInChI=1S/C19H16O7/c1-23-15-8-7-13-17(22)14(9-26-18(13)19(15)24-2)11-3-5-12(6-4-11)25-10-16(20)21/h3-9H,10H2,1-2H3,(H,20,21)
InChIKeyNXQGNIDMIJDGOB-UHFFFAOYSA-N
MW356.33 g/mol
LogP2.94
Rot. Bonds6

About 2-[4-(7,8-dimethoxy-4-oxochromen-3-yl)phenoxy]acetic acid

2-[4-(7,8-dimethoxy-4-oxochromen-3-yl)phenoxy]acetic acid (PubChem CID 54135854) has the molecular formula C19H16O7 and a molecular weight of 356.33 g/mol. Its IUPAC name is 2-[4-(7,8-dimethoxy-4-oxochromen-3-yl)phenoxy]acetic acid.

Molecular Properties

Compound Name2-[4-(7,8-dimethoxy-4-oxochromen-3-yl)phenoxy]acetic acid
PubChem CID54135854
Molecular FormulaC19H16O7
Molecular Weight356.33 g/mol
Exact Mass356.09
IUPAC Name2-[4-(7,8-dimethoxy-4-oxochromen-3-yl)phenoxy]acetic acid
SMILESCOc1ccc2c(=O)c(-c3ccc(OCC(=O)O)cc3)coc2c1OC
InChIInChI=1S/C19H16O7/c1-23-15-8-7-13-17(22)14(9-26-18(13)19(15)24-2)11-3-5-12(6-4-11)25-10-16(20)21/h3-9H,10H2,1-2H3,(H,20,21)
InChIKeyNXQGNIDMIJDGOB-UHFFFAOYSA-N
XLogP2.94
TPSA95.20 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500356.33
LogP ≤ 52.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 2-[4-(7,8-dimethoxy-4-oxochromen-3-yl)phenoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(7,8-dimethoxy-4-oxochromen-3-yl)phenoxy]acetic acid?
The IUPAC name of 2-[4-(7,8-dimethoxy-4-oxochromen-3-yl)phenoxy]acetic acid (CID 54135854) is 2-[4-(7,8-dimethoxy-4-oxochromen-3-yl)phenoxy]acetic acid.
What is the SMILES notation for 2-[4-(7,8-dimethoxy-4-oxochromen-3-yl)phenoxy]acetic acid?
The canonical SMILES for 2-[4-(7,8-dimethoxy-4-oxochromen-3-yl)phenoxy]acetic acid is COc1ccc2c(=O)c(-c3ccc(OCC(=O)O)cc3)coc2c1OC.
What is the InChIKey of 2-[4-(7,8-dimethoxy-4-oxochromen-3-yl)phenoxy]acetic acid?
The InChIKey is NXQGNIDMIJDGOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O7/c1-23-15-8-7-13-17(22)14(9-26-18(13)19(15)24-2)11-3-5-12(6-4-11)25-10-16(20)21/h3-9H,10H2,1-2H3,(H,20,21).
What are the key properties of 2-[4-(7,8-dimethoxy-4-oxochromen-3-yl)phenoxy]acetic acid?
2-[4-(7,8-dimethoxy-4-oxochromen-3-yl)phenoxy]acetic acid has a molecular weight of 356.33 g/mol, XLogP of 2.94, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(7,8-dimethoxy-4-oxochromen-3-yl)phenoxy]acetic acid is sourced from PubChem (CID 54135854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).