C24H24O6 — CID 142669564
2-[4-[7-(cyclohexylmethoxy)-4-oxochromen-3-yl]phenoxy]acetic acid (PubChem CID 142669564) has the molecular formula C24H24O6 and a molecular weight of 408.45 g/mol. Its IUPAC name is 2-[4-[7-(cyclohexylmethoxy)-4-oxochromen-3-yl]phenoxy]acetic acid.
| Compound Name | 2-[4-[7-(cyclohexylmethoxy)-4-oxochromen-3-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 142669564 |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 2-[4-[7-(cyclohexylmethoxy)-4-oxochromen-3-yl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(-c2coc3cc(OCC4CCCCC4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C24H24O6/c25-23(26)15-29-18-8-6-17(7-9-18)21-14-30-22-12-19(10-11-20(22)24(21)27)28-13-16-4-2-1-3-5-16/h6-12,14,16H,1-5,13,15H2,(H,25,26) |
| InChIKey | NOOBMHDJUISYMA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |