C20H19NO3S — CID 145078733
3-[4-(cyclopropylmethoxy)phenyl]-7-[methyl(sulfanyl)amino]chromen-4-one (PubChem CID 145078733) has the molecular formula C20H19NO3S and a molecular weight of 353.44 g/mol. Its IUPAC name is 3-[4-(cyclopropylmethoxy)phenyl]-7-[methyl(sulfanyl)amino]chromen-4-one.
| Compound Name | 3-[4-(cyclopropylmethoxy)phenyl]-7-[methyl(sulfanyl)amino]chromen-4-one |
|---|---|
| PubChem CID | 145078733 |
| Molecular Formula | C20H19NO3S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 3-[4-(cyclopropylmethoxy)phenyl]-7-[methyl(sulfanyl)amino]chromen-4-one |
| SMILES | CN(S)c1ccc2c(=O)c(-c3ccc(OCC4CC4)cc3)coc2c1 |
| InChI | InChI=1S/C20H19NO3S/c1-21(25)15-6-9-17-19(10-15)24-12-18(20(17)22)14-4-7-16(8-5-14)23-11-13-2-3-13/h4-10,12-13,25H,2-3,11H2,1H3 |
| InChIKey | SZYJVKOBFLUXAU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 42.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|