About [3-(4-bromophenyl)-4-oxochromen-7-yl] cyclopropanecarboxylate
[3-(4-bromophenyl)-4-oxochromen-7-yl] cyclopropanecarboxylate (PubChem CID 2012086) has the molecular formula C19H13BrO4
and a molecular weight of 385.21 g/mol. Its IUPAC name is [3-(4-bromophenyl)-4-oxochromen-7-yl] cyclopropanecarboxylate.
Molecular Properties
| Compound Name | [3-(4-bromophenyl)-4-oxochromen-7-yl] cyclopropanecarboxylate |
| PubChem CID | 2012086 |
| Molecular Formula | C19H13BrO4 |
| Molecular Weight | 385.21 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | [3-(4-bromophenyl)-4-oxochromen-7-yl] cyclopropanecarboxylate |
| SMILES | O=C(Oc1ccc2c(=O)c(-c3ccc(Br)cc3)coc2c1)C1CC1 |
| InChI | InChI=1S/C19H13BrO4/c20-13-5-3-11(4-6-13)16-10-23-17-9-14(7-8-15(17)18(16)21)24-19(22)12-1-2-12/h3-10,12H,1-2H2 |
| InChIKey | SDWXBCNLXWBJJI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.21 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-bromophenyl)-4-oxochromen-7-yl] cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-bromophenyl)-4-oxochromen-7-yl] cyclopropanecarboxylate?
The IUPAC name of [3-(4-bromophenyl)-4-oxochromen-7-yl] cyclopropanecarboxylate (CID 2012086) is [3-(4-bromophenyl)-4-oxochromen-7-yl] cyclopropanecarboxylate.
What is the SMILES notation for [3-(4-bromophenyl)-4-oxochromen-7-yl] cyclopropanecarboxylate?
The canonical SMILES for [3-(4-bromophenyl)-4-oxochromen-7-yl] cyclopropanecarboxylate is O=C(Oc1ccc2c(=O)c(-c3ccc(Br)cc3)coc2c1)C1CC1.
What is the InChIKey of [3-(4-bromophenyl)-4-oxochromen-7-yl] cyclopropanecarboxylate?
The InChIKey is SDWXBCNLXWBJJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13BrO4/c20-13-5-3-11(4-6-13)16-10-23-17-9-14(7-8-15(17)18(16)21)24-19(22)12-1-2-12/h3-10,12H,1-2H2.
What are the key properties of [3-(4-bromophenyl)-4-oxochromen-7-yl] cyclopropanecarboxylate?
[3-(4-bromophenyl)-4-oxochromen-7-yl] cyclopropanecarboxylate has a molecular weight of 385.21 g/mol, XLogP of 4.54, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-bromophenyl)-4-oxochromen-7-yl] cyclopropanecarboxylate is sourced from PubChem (CID 2012086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).