C21H8F10O6 — CID 91710836
[4-[4-oxo-7-(2,2,3,3,3-pentafluoropropanoyloxy)chromen-3-yl]phenyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91710836) has the molecular formula C21H8F10O6 and a molecular weight of 546.27 g/mol. Its IUPAC name is [4-[4-oxo-7-(2,2,3,3,3-pentafluoropropanoyloxy)chromen-3-yl]phenyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [4-[4-oxo-7-(2,2,3,3,3-pentafluoropropanoyloxy)chromen-3-yl]phenyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91710836 |
| Molecular Formula | C21H8F10O6 |
| Molecular Weight | 546.27 g/mol |
| Exact Mass | 546.02 |
| IUPAC Name | [4-[4-oxo-7-(2,2,3,3,3-pentafluoropropanoyloxy)chromen-3-yl]phenyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(Oc1ccc(-c2coc3cc(OC(=O)C(F)(F)C(F)(F)F)ccc3c2=O)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H8F10O6/c22-18(23,20(26,27)28)16(33)36-10-3-1-9(2-4-10)13-8-35-14-7-11(5-6-12(14)15(13)32)37-17(34)19(24,25)21(29,30)31/h1-8H |
| InChIKey | KCMZVTIJKXOBSC-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.27 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|