C27H33FO4 — CID 170734650
3-[3-(10-fluorodecyl)phenyl]-7,8-dimethoxychromen-4-one (PubChem CID 170734650) has the molecular formula C27H33FO4 and a molecular weight of 440.56 g/mol. Its IUPAC name is 3-[3-(10-fluorodecyl)phenyl]-7,8-dimethoxychromen-4-one.
| Compound Name | 3-[3-(10-fluorodecyl)phenyl]-7,8-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 170734650 |
| Molecular Formula | C27H33FO4 |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 3-[3-(10-fluorodecyl)phenyl]-7,8-dimethoxychromen-4-one |
| SMILES | COc1ccc2c(=O)c(-c3cccc(CCCCCCCCCCF)c3)coc2c1OC |
| InChI | InChI=1S/C27H33FO4/c1-30-24-16-15-22-25(29)23(19-32-26(22)27(24)31-2)21-14-11-13-20(18-21)12-9-7-5-3-4-6-8-10-17-28/h11,13-16,18-19H,3-10,12,17H2,1-2H3 |
| InChIKey | BDBNBLYSFFSDMV-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|