About 5-[2-(3,4-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methylsulfinylpyrimidine
5-[2-(3,4-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methylsulfinylpyrimidine (PubChem CID 174640688) has the molecular formula C16H16N4O3S
and a molecular weight of 344.40 g/mol. Its IUPAC name is 5-[2-(3,4-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methylsulfinylpyrimidine.
Molecular Properties
| Compound Name | 5-[2-(3,4-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methylsulfinylpyrimidine |
| PubChem CID | 174640688 |
| Molecular Formula | C16H16N4O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 5-[2-(3,4-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methylsulfinylpyrimidine |
| SMILES | COc1ccc(-c2ncc(-c3cnc(S(C)=O)nc3)[nH]2)cc1OC |
| InChI | InChI=1S/C16H16N4O3S/c1-22-13-5-4-10(6-14(13)23-2)15-17-9-12(20-15)11-7-18-16(19-8-11)24(3)21/h4-9H,1-3H3,(H,17,20) |
| InChIKey | GMXNYJFYXQPVDB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[2-(3,4-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methylsulfinylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(3,4-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methylsulfinylpyrimidine?
The IUPAC name of 5-[2-(3,4-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methylsulfinylpyrimidine (CID 174640688) is 5-[2-(3,4-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methylsulfinylpyrimidine.
What is the SMILES notation for 5-[2-(3,4-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methylsulfinylpyrimidine?
The canonical SMILES for 5-[2-(3,4-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methylsulfinylpyrimidine is COc1ccc(-c2ncc(-c3cnc(S(C)=O)nc3)[nH]2)cc1OC.
What is the InChIKey of 5-[2-(3,4-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methylsulfinylpyrimidine?
The InChIKey is GMXNYJFYXQPVDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O3S/c1-22-13-5-4-10(6-14(13)23-2)15-17-9-12(20-15)11-7-18-16(19-8-11)24(3)21/h4-9H,1-3H3,(H,17,20).
What are the key properties of 5-[2-(3,4-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methylsulfinylpyrimidine?
5-[2-(3,4-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methylsulfinylpyrimidine has a molecular weight of 344.40 g/mol, XLogP of 2.29, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(3,4-dimethoxyphenyl)-1H-imidazol-5-yl]-2-methylsulfinylpyrimidine is sourced from PubChem (CID 174640688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).