C15H17NO5 — CID 102453349
methyl 5-(3,4,5-trimethoxyphenyl)-1H-pyrrole-2-carboxylate (PubChem CID 102453349) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is methyl 5-(3,4,5-trimethoxyphenyl)-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 5-(3,4,5-trimethoxyphenyl)-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 102453349 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | methyl 5-(3,4,5-trimethoxyphenyl)-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1ccc(-c2cc(OC)c(OC)c(OC)c2)[nH]1 |
| InChI | InChI=1S/C15H17NO5/c1-18-12-7-9(8-13(19-2)14(12)20-3)10-5-6-11(16-10)15(17)21-4/h5-8,16H,1-4H3 |
| InChIKey | ULOUPYDUYZBOIN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |