C22H21Cl2N3O5 — CID 45029264
methyl 2-[(2E)-2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-5-(3,4,5-trimethoxyphenyl)-1H-pyrrole-3-carboxylate (PubChem CID 45029264) has the molecular formula C22H21Cl2N3O5 and a molecular weight of 478.33 g/mol. Its IUPAC name is methyl 2-[(2E)-2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-5-(3,4,5-trimethoxyphenyl)-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 2-[(2E)-2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-5-(3,4,5-trimethoxyphenyl)-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 45029264 |
| Molecular Formula | C22H21Cl2N3O5 |
| Molecular Weight | 478.33 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | methyl 2-[(2E)-2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-5-(3,4,5-trimethoxyphenyl)-1H-pyrrole-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2cc(OC)c(OC)c(OC)c2)[nH]c1N/N=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C22H21Cl2N3O5/c1-29-18-8-12(9-19(30-2)20(18)31-3)17-10-13(22(28)32-4)21(26-17)27-25-11-14-15(23)6-5-7-16(14)24/h5-11,26-27H,1-4H3/b25-11+ |
| InChIKey | ILKOFSMUTKQSAL-OPEKNORGSA-N |
| XLogP | 5.25 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.33 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|