C41H39BN2O8 — CID 102196594
(Z)-3-diphenylboranyloxy-1,3-bis[5-(3,4,5-trimethoxyphenyl)-1H-pyrrol-2-yl]prop-2-en-1-one (PubChem CID 102196594) has the molecular formula C41H39BN2O8 and a molecular weight of 698.58 g/mol. Its IUPAC name is (Z)-3-diphenylboranyloxy-1,3-bis[5-(3,4,5-trimethoxyphenyl)-1H-pyrrol-2-yl]prop-2-en-1-one.
| Compound Name | (Z)-3-diphenylboranyloxy-1,3-bis[5-(3,4,5-trimethoxyphenyl)-1H-pyrrol-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 102196594 |
| Molecular Formula | C41H39BN2O8 |
| Molecular Weight | 698.58 g/mol |
| Exact Mass | 698.28 |
| IUPAC Name | (Z)-3-diphenylboranyloxy-1,3-bis[5-(3,4,5-trimethoxyphenyl)-1H-pyrrol-2-yl]prop-2-en-1-one |
| SMILES | COc1cc(-c2ccc(C(=O)/C=C(\OB(c3ccccc3)c3ccccc3)c3ccc(-c4cc(OC)c(OC)c(OC)c4)[nH]3)[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C41H39BN2O8/c1-46-36-21-26(22-37(47-2)40(36)50-5)30-17-19-32(43-30)34(45)25-35(52-42(28-13-9-7-10-14-28)29-15-11-8-12-16-29)33-20-18-31(44-33)27-23-38(48-3)41(51-6)39(24-27)49-4/h7-25,43-44H,1-6H3/b35-25- |
| InChIKey | OWWDDKVIQYCNEG-CKWSZQMZSA-N |
| XLogP | 6.77 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.58 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|