C26H26N2O4 — CID 43074909
5,6,7-trimethoxy-N-[1-(4-phenylphenyl)ethyl]-1H-indole-2-carboxamide (PubChem CID 43074909) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 5,6,7-trimethoxy-N-[1-(4-phenylphenyl)ethyl]-1H-indole-2-carboxamide.
| Compound Name | 5,6,7-trimethoxy-N-[1-(4-phenylphenyl)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 43074909 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 5,6,7-trimethoxy-N-[1-(4-phenylphenyl)ethyl]-1H-indole-2-carboxamide |
| SMILES | COc1cc2cc(C(=O)NC(C)c3ccc(-c4ccccc4)cc3)[nH]c2c(OC)c1OC |
| InChI | InChI=1S/C26H26N2O4/c1-16(17-10-12-19(13-11-17)18-8-6-5-7-9-18)27-26(29)21-14-20-15-22(30-2)24(31-3)25(32-4)23(20)28-21/h5-16,28H,1-4H3,(H,27,29) |
| InChIKey | KMIYFFLLAXHNBI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |