C22H26N2O4 — CID 47027000
N-(4-tert-butylphenyl)-5,6,7-trimethoxy-1H-indole-2-carboxamide (PubChem CID 47027000) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-5,6,7-trimethoxy-1H-indole-2-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-5,6,7-trimethoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 47027000 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | N-(4-tert-butylphenyl)-5,6,7-trimethoxy-1H-indole-2-carboxamide |
| SMILES | COc1cc2cc(C(=O)Nc3ccc(C(C)(C)C)cc3)[nH]c2c(OC)c1OC |
| InChI | InChI=1S/C22H26N2O4/c1-22(2,3)14-7-9-15(10-8-14)23-21(25)16-11-13-12-17(26-4)19(27-5)20(28-6)18(13)24-16/h7-12,24H,1-6H3,(H,23,25) |
| InChIKey | GSHCRGQMAHNQHX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |