C11H7F2N3O — CID 116879938
5-(2,5-difluoro-4-methoxyphenyl)-1H-imidazole-2-carbonitrile (PubChem CID 116879938) has the molecular formula C11H7F2N3O and a molecular weight of 235.19 g/mol. Its IUPAC name is 5-(2,5-difluoro-4-methoxyphenyl)-1H-imidazole-2-carbonitrile.
| Compound Name | 5-(2,5-difluoro-4-methoxyphenyl)-1H-imidazole-2-carbonitrile |
|---|---|
| PubChem CID | 116879938 |
| Molecular Formula | C11H7F2N3O |
| Molecular Weight | 235.19 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 5-(2,5-difluoro-4-methoxyphenyl)-1H-imidazole-2-carbonitrile |
| SMILES | COc1cc(F)c(-c2cnc(C#N)[nH]2)cc1F |
| InChI | InChI=1S/C11H7F2N3O/c1-17-10-3-7(12)6(2-8(10)13)9-5-15-11(4-14)16-9/h2-3,5H,1H3,(H,15,16) |
| InChIKey | VZUFPPDQPBCUTO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.19 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |