C11H11F2N3O — CID 116827288
5-(2,5-difluoro-4-methoxyphenyl)-N-methyl-1H-pyrazol-3-amine (PubChem CID 116827288) has the molecular formula C11H11F2N3O and a molecular weight of 239.22 g/mol. Its IUPAC name is 5-(2,5-difluoro-4-methoxyphenyl)-N-methyl-1H-pyrazol-3-amine.
| Compound Name | 5-(2,5-difluoro-4-methoxyphenyl)-N-methyl-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 116827288 |
| Molecular Formula | C11H11F2N3O |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 5-(2,5-difluoro-4-methoxyphenyl)-N-methyl-1H-pyrazol-3-amine |
| SMILES | CNc1cc(-c2cc(F)c(OC)cc2F)[nH]n1 |
| InChI | InChI=1S/C11H11F2N3O/c1-14-11-5-9(15-16-11)6-3-8(13)10(17-2)4-7(6)12/h3-5H,1-2H3,(H2,14,15,16) |
| InChIKey | VWAQYULBZGUFOP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |