C11H9F2NO2S — CID 116967804
4-(2,5-difluoro-4-methoxyphenyl)-2-methoxy-1,3-thiazole (PubChem CID 116967804) has the molecular formula C11H9F2NO2S and a molecular weight of 257.26 g/mol. Its IUPAC name is 4-(2,5-difluoro-4-methoxyphenyl)-2-methoxy-1,3-thiazole.
| Compound Name | 4-(2,5-difluoro-4-methoxyphenyl)-2-methoxy-1,3-thiazole |
|---|---|
| PubChem CID | 116967804 |
| Molecular Formula | C11H9F2NO2S |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 4-(2,5-difluoro-4-methoxyphenyl)-2-methoxy-1,3-thiazole |
| SMILES | COc1nc(-c2cc(F)c(OC)cc2F)cs1 |
| InChI | InChI=1S/C11H9F2NO2S/c1-15-10-4-7(12)6(3-8(10)13)9-5-17-11(14-9)16-2/h3-5H,1-2H3 |
| InChIKey | LPTTXQZVABLRQM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |