C13H13F2N3O — CID 116897723
2-[4-(2,5-difluoro-4-methoxyphenyl)pyrimidin-2-yl]ethanamine (PubChem CID 116897723) has the molecular formula C13H13F2N3O and a molecular weight of 265.26 g/mol. Its IUPAC name is 2-[4-(2,5-difluoro-4-methoxyphenyl)pyrimidin-2-yl]ethanamine.
| Compound Name | 2-[4-(2,5-difluoro-4-methoxyphenyl)pyrimidin-2-yl]ethanamine |
|---|---|
| PubChem CID | 116897723 |
| Molecular Formula | C13H13F2N3O |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2-[4-(2,5-difluoro-4-methoxyphenyl)pyrimidin-2-yl]ethanamine |
| SMILES | COc1cc(F)c(-c2ccnc(CCN)n2)cc1F |
| InChI | InChI=1S/C13H13F2N3O/c1-19-12-7-9(14)8(6-10(12)15)11-3-5-17-13(18-11)2-4-16/h3,5-7H,2,4,16H2,1H3 |
| InChIKey | USIQFDRIIPPOKR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |