C15H14N2O3S — CID 57336301
2-sulfanylidene-6-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile (PubChem CID 57336301) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is 2-sulfanylidene-6-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile.
| Compound Name | 2-sulfanylidene-6-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 57336301 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-sulfanylidene-6-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile |
| SMILES | COc1cc(-c2ccc(C#N)c(=S)[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C15H14N2O3S/c1-18-12-6-10(7-13(19-2)14(12)20-3)11-5-4-9(8-16)15(21)17-11/h4-7H,1-3H3,(H,17,21) |
| InChIKey | DJJZHVUUDAPNCQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|