C24H20N2O6 — CID 25111917
3-amino-2-(7-amino-1-methoxy-3-methyl-5,8-dioxonaphthalen-2-yl)-5-methoxy-7-methylnaphthalene-1,4-dione (PubChem CID 25111917) has the molecular formula C24H20N2O6 and a molecular weight of 432.43 g/mol. Its IUPAC name is 3-amino-2-(7-amino-1-methoxy-3-methyl-5,8-dioxonaphthalen-2-yl)-5-methoxy-7-methylnaphthalene-1,4-dione.
| Compound Name | 3-amino-2-(7-amino-1-methoxy-3-methyl-5,8-dioxonaphthalen-2-yl)-5-methoxy-7-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 25111917 |
| Molecular Formula | C24H20N2O6 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 3-amino-2-(7-amino-1-methoxy-3-methyl-5,8-dioxonaphthalen-2-yl)-5-methoxy-7-methylnaphthalene-1,4-dione |
| SMILES | COc1cc(C)cc2c1C(=O)C(N)=C(c1c(C)cc3c(c1OC)C(=O)C(N)=CC3=O)C2=O |
| InChI | InChI=1S/C24H20N2O6/c1-9-5-12-17(15(6-9)31-3)23(30)20(26)19(21(12)28)16-10(2)7-11-14(27)8-13(25)22(29)18(11)24(16)32-4/h5-8H,25-26H2,1-4H3 |
| InChIKey | UOXVCQMAYCSSEC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|