C24H19NO6 — CID 25112029
2-amino-8-methoxy-7-(5-methoxy-7-methyl-1,4-dioxonaphthalen-2-yl)-6-methylnaphthalene-1,4-dione (PubChem CID 25112029) has the molecular formula C24H19NO6 and a molecular weight of 417.42 g/mol. Its IUPAC name is 2-amino-8-methoxy-7-(5-methoxy-7-methyl-1,4-dioxonaphthalen-2-yl)-6-methylnaphthalene-1,4-dione.
| Compound Name | 2-amino-8-methoxy-7-(5-methoxy-7-methyl-1,4-dioxonaphthalen-2-yl)-6-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 25112029 |
| Molecular Formula | C24H19NO6 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 2-amino-8-methoxy-7-(5-methoxy-7-methyl-1,4-dioxonaphthalen-2-yl)-6-methylnaphthalene-1,4-dione |
| SMILES | COc1cc(C)cc2c1C(=O)C=C(c1c(C)cc3c(c1OC)C(=O)C(N)=CC3=O)C2=O |
| InChI | InChI=1S/C24H19NO6/c1-10-5-13-20(18(6-10)30-3)17(27)8-14(22(13)28)19-11(2)7-12-16(26)9-15(25)23(29)21(12)24(19)31-4/h5-9H,25H2,1-4H3 |
| InChIKey | OJUOCWOXTDOHQP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|