C16H11ClO4 — CID 44550924
3-chloro-5,8-dimethoxyphenanthrene-1,4-dione (PubChem CID 44550924) has the molecular formula C16H11ClO4 and a molecular weight of 302.71 g/mol. Its IUPAC name is 3-chloro-5,8-dimethoxyphenanthrene-1,4-dione.
| Compound Name | 3-chloro-5,8-dimethoxyphenanthrene-1,4-dione |
|---|---|
| PubChem CID | 44550924 |
| Molecular Formula | C16H11ClO4 |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 3-chloro-5,8-dimethoxyphenanthrene-1,4-dione |
| SMILES | COc1ccc(OC)c2c3c(ccc12)C(=O)C=C(Cl)C3=O |
| InChI | InChI=1S/C16H11ClO4/c1-20-12-5-6-13(21-2)14-9(12)4-3-8-11(18)7-10(17)16(19)15(8)14/h3-7H,1-2H3 |
| InChIKey | AJEAPALSYRKLAE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|