About 2,3-dimethoxybicyclo[4.1.0]hepta-1(6),2,4-trien-7-one
2,3-dimethoxybicyclo[4.1.0]hepta-1(6),2,4-trien-7-one (PubChem CID 174869830) has the molecular formula C9H8O3
and a molecular weight of 164.16 g/mol. Its IUPAC name is 2,3-dimethoxybicyclo[4.1.0]hepta-1(6),2,4-trien-7-one.
Analyze 2,3-dimethoxybicyclo[4.1.0]hepta-1(6),2,4-trien-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethoxybicyclo[4.1.0]hepta-1(6),2,4-trien-7-one?
The IUPAC name of 2,3-dimethoxybicyclo[4.1.0]hepta-1(6),2,4-trien-7-one (CID 174869830) is 2,3-dimethoxybicyclo[4.1.0]hepta-1(6),2,4-trien-7-one.
What is the SMILES notation for 2,3-dimethoxybicyclo[4.1.0]hepta-1(6),2,4-trien-7-one?
The canonical SMILES for 2,3-dimethoxybicyclo[4.1.0]hepta-1(6),2,4-trien-7-one is COc1ccc2c(=O)c2c1OC.
What is the InChIKey of 2,3-dimethoxybicyclo[4.1.0]hepta-1(6),2,4-trien-7-one?
The InChIKey is WNLOXEJHRJTYRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3/c1-11-6-4-3-5-7(8(5)10)9(6)12-2/h3-4H,1-2H3.
What are the key properties of 2,3-dimethoxybicyclo[4.1.0]hepta-1(6),2,4-trien-7-one?
2,3-dimethoxybicyclo[4.1.0]hepta-1(6),2,4-trien-7-one has a molecular weight of 164.16 g/mol, XLogP of 1.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxybicyclo[4.1.0]hepta-1(6),2,4-trien-7-one is sourced from PubChem (CID 174869830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).