3,4,6-trimethoxy-5-oxobenzo[7]annulene-8-carboxylic acid

C15H14O6 — CID 155525328

IUPAC3,4,6-trimethoxy-5-oxobenzo[7]annulene-8-carboxylic acid
SMILESCOc1ccc2cc(C(=O)O)cc(OC)c(=O)c2c1OC
InChIInChI=1S/C15H14O6/c1-19-10-5-4-8-6-9(15(17)18)7-11(20-2)13(16)12(8)14(10)21-3/h4-7H,1-3H3,(H,17,18)
InChIKeyBCJYUYTWKUREPM-UHFFFAOYSA-N
MW290.27 g/mol
LogP1.92
Rot. Bonds4

About 3,4,6-trimethoxy-5-oxobenzo[7]annulene-8-carboxylic acid

3,4,6-trimethoxy-5-oxobenzo[7]annulene-8-carboxylic acid (PubChem CID 155525328) has the molecular formula C15H14O6 and a molecular weight of 290.27 g/mol. Its IUPAC name is 3,4,6-trimethoxy-5-oxobenzo[7]annulene-8-carboxylic acid.

Molecular Properties

Compound Name3,4,6-trimethoxy-5-oxobenzo[7]annulene-8-carboxylic acid
PubChem CID155525328
Molecular FormulaC15H14O6
Molecular Weight290.27 g/mol
Exact Mass290.08
IUPAC Name3,4,6-trimethoxy-5-oxobenzo[7]annulene-8-carboxylic acid
SMILESCOc1ccc2cc(C(=O)O)cc(OC)c(=O)c2c1OC
InChIInChI=1S/C15H14O6/c1-19-10-5-4-8-6-9(15(17)18)7-11(20-2)13(16)12(8)14(10)21-3/h4-7H,1-3H3,(H,17,18)
InChIKeyBCJYUYTWKUREPM-UHFFFAOYSA-N
XLogP1.92
TPSA82.06 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.27
LogP ≤ 51.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3,4,6-trimethoxy-5-oxobenzo[7]annulene-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4,6-trimethoxy-5-oxobenzo[7]annulene-8-carboxylic acid?
The IUPAC name of 3,4,6-trimethoxy-5-oxobenzo[7]annulene-8-carboxylic acid (CID 155525328) is 3,4,6-trimethoxy-5-oxobenzo[7]annulene-8-carboxylic acid.
What is the SMILES notation for 3,4,6-trimethoxy-5-oxobenzo[7]annulene-8-carboxylic acid?
The canonical SMILES for 3,4,6-trimethoxy-5-oxobenzo[7]annulene-8-carboxylic acid is COc1ccc2cc(C(=O)O)cc(OC)c(=O)c2c1OC.
What is the InChIKey of 3,4,6-trimethoxy-5-oxobenzo[7]annulene-8-carboxylic acid?
The InChIKey is BCJYUYTWKUREPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O6/c1-19-10-5-4-8-6-9(15(17)18)7-11(20-2)13(16)12(8)14(10)21-3/h4-7H,1-3H3,(H,17,18).
What are the key properties of 3,4,6-trimethoxy-5-oxobenzo[7]annulene-8-carboxylic acid?
3,4,6-trimethoxy-5-oxobenzo[7]annulene-8-carboxylic acid has a molecular weight of 290.27 g/mol, XLogP of 1.92, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,6-trimethoxy-5-oxobenzo[7]annulene-8-carboxylic acid is sourced from PubChem (CID 155525328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).