C15H10O7 — CID 156761592
8,9-dimethoxy-1,3-dioxobenzo[f][2]benzofuran-6-carboxylic acid (PubChem CID 156761592) has the molecular formula C15H10O7 and a molecular weight of 302.24 g/mol. Its IUPAC name is 8,9-dimethoxy-1,3-dioxobenzo[f][2]benzofuran-6-carboxylic acid.
| Compound Name | 8,9-dimethoxy-1,3-dioxobenzo[f][2]benzofuran-6-carboxylic acid |
|---|---|
| PubChem CID | 156761592 |
| Molecular Formula | C15H10O7 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 8,9-dimethoxy-1,3-dioxobenzo[f][2]benzofuran-6-carboxylic acid |
| SMILES | COc1cc(C(=O)O)cc2cc3c(c(OC)c12)C(=O)OC3=O |
| InChI | InChI=1S/C15H10O7/c1-20-9-5-7(13(16)17)3-6-4-8-11(12(21-2)10(6)9)15(19)22-14(8)18/h3-5H,1-2H3,(H,16,17) |
| InChIKey | QXDTUBNHOATGCC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|