8,9-dimethoxy-1,3-dioxobenzo[f][2]benzofuran-6-carboxylic acid

C15H10O7 — CID 156761592

IUPAC8,9-dimethoxy-1,3-dioxobenzo[f][2]benzofuran-6-carboxylic acid
SMILESCOc1cc(C(=O)O)cc2cc3c(c(OC)c12)C(=O)OC3=O
InChIInChI=1S/C15H10O7/c1-20-9-5-7(13(16)17)3-6-4-8-11(12(21-2)10(6)9)15(19)22-14(8)18/h3-5H,1-2H3,(H,16,17)
InChIKeyQXDTUBNHOATGCC-UHFFFAOYSA-N
MW302.24 g/mol
LogP1.87
Rot. Bonds3

About 8,9-dimethoxy-1,3-dioxobenzo[f][2]benzofuran-6-carboxylic acid

8,9-dimethoxy-1,3-dioxobenzo[f][2]benzofuran-6-carboxylic acid (PubChem CID 156761592) has the molecular formula C15H10O7 and a molecular weight of 302.24 g/mol. Its IUPAC name is 8,9-dimethoxy-1,3-dioxobenzo[f][2]benzofuran-6-carboxylic acid.

Molecular Properties

Compound Name8,9-dimethoxy-1,3-dioxobenzo[f][2]benzofuran-6-carboxylic acid
PubChem CID156761592
Molecular FormulaC15H10O7
Molecular Weight302.24 g/mol
Exact Mass302.04
IUPAC Name8,9-dimethoxy-1,3-dioxobenzo[f][2]benzofuran-6-carboxylic acid
SMILESCOc1cc(C(=O)O)cc2cc3c(c(OC)c12)C(=O)OC3=O
InChIInChI=1S/C15H10O7/c1-20-9-5-7(13(16)17)3-6-4-8-11(12(21-2)10(6)9)15(19)22-14(8)18/h3-5H,1-2H3,(H,16,17)
InChIKeyQXDTUBNHOATGCC-UHFFFAOYSA-N
XLogP1.87
TPSA99.13 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.24
LogP ≤ 51.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 8,9-dimethoxy-1,3-dioxobenzo[f][2]benzofuran-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8,9-dimethoxy-1,3-dioxobenzo[f][2]benzofuran-6-carboxylic acid?
The IUPAC name of 8,9-dimethoxy-1,3-dioxobenzo[f][2]benzofuran-6-carboxylic acid (CID 156761592) is 8,9-dimethoxy-1,3-dioxobenzo[f][2]benzofuran-6-carboxylic acid.
What is the SMILES notation for 8,9-dimethoxy-1,3-dioxobenzo[f][2]benzofuran-6-carboxylic acid?
The canonical SMILES for 8,9-dimethoxy-1,3-dioxobenzo[f][2]benzofuran-6-carboxylic acid is COc1cc(C(=O)O)cc2cc3c(c(OC)c12)C(=O)OC3=O.
What is the InChIKey of 8,9-dimethoxy-1,3-dioxobenzo[f][2]benzofuran-6-carboxylic acid?
The InChIKey is QXDTUBNHOATGCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O7/c1-20-9-5-7(13(16)17)3-6-4-8-11(12(21-2)10(6)9)15(19)22-14(8)18/h3-5H,1-2H3,(H,16,17).
What are the key properties of 8,9-dimethoxy-1,3-dioxobenzo[f][2]benzofuran-6-carboxylic acid?
8,9-dimethoxy-1,3-dioxobenzo[f][2]benzofuran-6-carboxylic acid has a molecular weight of 302.24 g/mol, XLogP of 1.87, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dimethoxy-1,3-dioxobenzo[f][2]benzofuran-6-carboxylic acid is sourced from PubChem (CID 156761592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).