C16H17ClO2S — CID 19909011
6-chloro-2-hexylsulfanylnaphthalene-1,4-dione (PubChem CID 19909011) has the molecular formula C16H17ClO2S and a molecular weight of 308.83 g/mol. Its IUPAC name is 6-chloro-2-hexylsulfanylnaphthalene-1,4-dione.
| Compound Name | 6-chloro-2-hexylsulfanylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 19909011 |
| Molecular Formula | C16H17ClO2S |
| Molecular Weight | 308.83 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 6-chloro-2-hexylsulfanylnaphthalene-1,4-dione |
| SMILES | CCCCCCSC1=CC(=O)c2cc(Cl)ccc2C1=O |
| InChI | InChI=1S/C16H17ClO2S/c1-2-3-4-5-8-20-15-10-14(18)13-9-11(17)6-7-12(13)16(15)19/h6-7,9-10H,2-5,8H2,1H3 |
| InChIKey | XCYCCUATQDCLDL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.83 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|