C15H17ClO — CID 10490816
6-chloro-2,3-dipropylinden-1-one (PubChem CID 10490816) has the molecular formula C15H17ClO and a molecular weight of 248.75 g/mol. Its IUPAC name is 6-chloro-2,3-dipropylinden-1-one.
| Compound Name | 6-chloro-2,3-dipropylinden-1-one |
|---|---|
| PubChem CID | 10490816 |
| Molecular Formula | C15H17ClO |
| Molecular Weight | 248.75 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 6-chloro-2,3-dipropylinden-1-one |
| SMILES | CCCC1=C(CCC)c2ccc(Cl)cc2C1=O |
| InChI | InChI=1S/C15H17ClO/c1-3-5-11-12-8-7-10(16)9-14(12)15(17)13(11)6-4-2/h7-9H,3-6H2,1-2H3 |
| InChIKey | FMLDJYWZOTVXPJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.75 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |