C15H17FO — CID 132609078
5-fluoro-2,3-dipropylinden-1-one (PubChem CID 132609078) has the molecular formula C15H17FO and a molecular weight of 232.30 g/mol. Its IUPAC name is 5-fluoro-2,3-dipropylinden-1-one.
| Compound Name | 5-fluoro-2,3-dipropylinden-1-one |
|---|---|
| PubChem CID | 132609078 |
| Molecular Formula | C15H17FO |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 5-fluoro-2,3-dipropylinden-1-one |
| SMILES | CCCC1=C(CCC)c2cc(F)ccc2C1=O |
| InChI | InChI=1S/C15H17FO/c1-3-5-11-12(6-4-2)15(17)13-8-7-10(16)9-14(11)13/h7-9H,3-6H2,1-2H3 |
| InChIKey | NMAHOEOSKLCVOZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |