C18H15F2NO2 — CID 167287400
6-fluoro-2-[(2Z,4E)-5-fluoro-2-(methylideneamino)hexa-2,4-dienyl]-3-methylnaphthalene-1,4-dione (PubChem CID 167287400) has the molecular formula C18H15F2NO2 and a molecular weight of 315.32 g/mol. Its IUPAC name is 6-fluoro-2-[(2Z,4E)-5-fluoro-2-(methylideneamino)hexa-2,4-dienyl]-3-methylnaphthalene-1,4-dione.
| Compound Name | 6-fluoro-2-[(2Z,4E)-5-fluoro-2-(methylideneamino)hexa-2,4-dienyl]-3-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 167287400 |
| Molecular Formula | C18H15F2NO2 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 6-fluoro-2-[(2Z,4E)-5-fluoro-2-(methylideneamino)hexa-2,4-dienyl]-3-methylnaphthalene-1,4-dione |
| SMILES | C=N/C(=C\C=C(/C)F)CC1=C(C)C(=O)c2cc(F)ccc2C1=O |
| InChI | InChI=1S/C18H15F2NO2/c1-10(19)4-6-13(21-3)9-15-11(2)17(22)16-8-12(20)5-7-14(16)18(15)23/h4-8H,3,9H2,1-2H3/b10-4+,13-6- |
| InChIKey | LXYKFUHUCMAPQS-RPGDPGDJSA-N |
| XLogP | 4.37 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|