C16H14ClFN2O2 — CID 166154032
N'-[(E)-3-(7-fluoro-3-methyl-1,4-dioxonaphthalen-2-yl)-2-methylprop-1-enyl]carbamimidoyl chloride (PubChem CID 166154032) has the molecular formula C16H14ClFN2O2 and a molecular weight of 320.75 g/mol. Its IUPAC name is N'-[(E)-3-(7-fluoro-3-methyl-1,4-dioxonaphthalen-2-yl)-2-methylprop-1-enyl]carbamimidoyl chloride.
| Compound Name | N'-[(E)-3-(7-fluoro-3-methyl-1,4-dioxonaphthalen-2-yl)-2-methylprop-1-enyl]carbamimidoyl chloride |
|---|---|
| PubChem CID | 166154032 |
| Molecular Formula | C16H14ClFN2O2 |
| Molecular Weight | 320.75 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N'-[(E)-3-(7-fluoro-3-methyl-1,4-dioxonaphthalen-2-yl)-2-methylprop-1-enyl]carbamimidoyl chloride |
| SMILES | CC1=C(C/C(C)=C/N=C(/N)Cl)C(=O)c2cc(F)ccc2C1=O |
| InChI | InChI=1S/C16H14ClFN2O2/c1-8(7-20-16(17)19)5-12-9(2)14(21)11-4-3-10(18)6-13(11)15(12)22/h3-4,6-7H,5H2,1-2H3,(H2,19,20)/b8-7+ |
| InChIKey | RYRFUWUCWDSFLH-BQYQJAHWSA-N |
| XLogP | 3.37 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.75 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|