C17H8F2OS — CID 169095983
4,12-difluoro-18-thiatetracyclo[13.2.1.02,7.09,14]octadeca-1(17),2(7),3,5,9(14),10,12,15-octaen-8-one (PubChem CID 169095983) has the molecular formula C17H8F2OS and a molecular weight of 298.31 g/mol. Its IUPAC name is 4,12-difluoro-18-thiatetracyclo[13.2.1.02,7.09,14]octadeca-1(17),2(7),3,5,9(14),10,12,15-octaen-8-one.
| Compound Name | 4,12-difluoro-18-thiatetracyclo[13.2.1.02,7.09,14]octadeca-1(17),2(7),3,5,9(14),10,12,15-octaen-8-one |
|---|---|
| PubChem CID | 169095983 |
| Molecular Formula | C17H8F2OS |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 4,12-difluoro-18-thiatetracyclo[13.2.1.02,7.09,14]octadeca-1(17),2(7),3,5,9(14),10,12,15-octaen-8-one |
| SMILES | O=C1c2ccc(F)cc2-c2ccc(s2)-c2cc(F)ccc21 |
| InChI | InChI=1S/C17H8F2OS/c18-9-1-3-11-13(7-9)15-5-6-16(21-15)14-8-10(19)2-4-12(14)17(11)20/h1-8H |
| InChIKey | JXXWSXIOBYVGFN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |