C32H29NO4 — CID 10696448
2-[5-(1,4-dioxonaphthalen-2-yl)-1-octylpyrrol-2-yl]naphthalene-1,4-dione (PubChem CID 10696448) has the molecular formula C32H29NO4 and a molecular weight of 491.59 g/mol. Its IUPAC name is 2-[5-(1,4-dioxonaphthalen-2-yl)-1-octylpyrrol-2-yl]naphthalene-1,4-dione.
| Compound Name | 2-[5-(1,4-dioxonaphthalen-2-yl)-1-octylpyrrol-2-yl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 10696448 |
| Molecular Formula | C32H29NO4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 2-[5-(1,4-dioxonaphthalen-2-yl)-1-octylpyrrol-2-yl]naphthalene-1,4-dione |
| SMILES | CCCCCCCCn1c(C2=CC(=O)c3ccccc3C2=O)ccc1C1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C32H29NO4/c1-2-3-4-5-6-11-18-33-27(25-19-29(34)21-12-7-9-14-23(21)31(25)36)16-17-28(33)26-20-30(35)22-13-8-10-15-24(22)32(26)37/h7-10,12-17,19-20H,2-6,11,18H2,1H3 |
| InChIKey | ABKXLGKRKBVUJX-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 73.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|