C18H8O2 — CID 10848652
pentacyclo[8.8.0.02,7.03,17.013,18]octadeca-1(10),2,6,8,11,13(18),14,16-octaene-4,5-dione (PubChem CID 10848652) has the molecular formula C18H8O2 and a molecular weight of 256.26 g/mol. Its IUPAC name is pentacyclo[8.8.0.02,7.03,17.013,18]octadeca-1(10),2,6,8,11,13(18),14,16-octaene-4,5-dione.
| Compound Name | pentacyclo[8.8.0.02,7.03,17.013,18]octadeca-1(10),2,6,8,11,13(18),14,16-octaene-4,5-dione |
|---|---|
| PubChem CID | 10848652 |
| Molecular Formula | C18H8O2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | pentacyclo[8.8.0.02,7.03,17.013,18]octadeca-1(10),2,6,8,11,13(18),14,16-octaene-4,5-dione |
| SMILES | O=C1C=c2ccc3ccc4cccc5c4c3c2=C5C1=O |
| InChI | InChI=1S/C18H8O2/c19-13-8-11-7-6-10-5-4-9-2-1-3-12-14(9)15(10)16(11)17(12)18(13)20/h1-8H |
| InChIKey | QRCZSGHOUXSNED-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|