About cobalt;10-oxothioxanthen-9-one
cobalt;10-oxothioxanthen-9-one (PubChem CID 158047817) has the molecular formula C13H8CoO2S
and a molecular weight of 287.20 g/mol. Its IUPAC name is cobalt;10-oxothioxanthen-9-one.
Molecular Properties
| Compound Name | cobalt;10-oxothioxanthen-9-one |
| PubChem CID | 158047817 |
| Molecular Formula | C13H8CoO2S |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.96 |
| IUPAC Name | cobalt;10-oxothioxanthen-9-one |
| SMILES | O=C1c2ccccc2S(=O)c2ccccc21.[Co] |
| InChI | InChI=1S/C13H8O2S.Co/c14-13-9-5-1-3-7-11(9)16(15)12-8-4-2-6-10(12)13;/h1-8H; |
| InChIKey | FJCWKHICLZWVRU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cobalt;10-oxothioxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;10-oxothioxanthen-9-one?
The IUPAC name of cobalt;10-oxothioxanthen-9-one (CID 158047817) is cobalt;10-oxothioxanthen-9-one.
What is the SMILES notation for cobalt;10-oxothioxanthen-9-one?
The canonical SMILES for cobalt;10-oxothioxanthen-9-one is O=C1c2ccccc2S(=O)c2ccccc21.[Co].
What is the InChIKey of cobalt;10-oxothioxanthen-9-one?
The InChIKey is FJCWKHICLZWVRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O2S.Co/c14-13-9-5-1-3-7-11(9)16(15)12-8-4-2-6-10(12)13;/h1-8H;.
What are the key properties of cobalt;10-oxothioxanthen-9-one?
cobalt;10-oxothioxanthen-9-one has a molecular weight of 287.20 g/mol, XLogP of 2.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;10-oxothioxanthen-9-one is sourced from PubChem (CID 158047817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).