About 2-methyldibenzothiophene 5-oxide
2-methyldibenzothiophene 5-oxide (PubChem CID 102526913) has the molecular formula C13H10OS
and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-methyldibenzothiophene 5-oxide.
Molecular Properties
| Compound Name | 2-methyldibenzothiophene 5-oxide |
| PubChem CID | 102526913 |
| Molecular Formula | C13H10OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 2-methyldibenzothiophene 5-oxide |
| SMILES | Cc1ccc2c(c1)-c1ccccc1S2=O |
| InChI | InChI=1S/C13H10OS/c1-9-6-7-13-11(8-9)10-4-2-3-5-12(10)15(13)14/h2-8H,1H3 |
| InChIKey | IEBZHDZOYIHUHA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyldibenzothiophene 5-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyldibenzothiophene 5-oxide?
The IUPAC name of 2-methyldibenzothiophene 5-oxide (CID 102526913) is 2-methyldibenzothiophene 5-oxide.
What is the SMILES notation for 2-methyldibenzothiophene 5-oxide?
The canonical SMILES for 2-methyldibenzothiophene 5-oxide is Cc1ccc2c(c1)-c1ccccc1S2=O.
What is the InChIKey of 2-methyldibenzothiophene 5-oxide?
The InChIKey is IEBZHDZOYIHUHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10OS/c1-9-6-7-13-11(8-9)10-4-2-3-5-12(10)15(13)14/h2-8H,1H3.
What are the key properties of 2-methyldibenzothiophene 5-oxide?
2-methyldibenzothiophene 5-oxide has a molecular weight of 214.29 g/mol, XLogP of 3.14, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyldibenzothiophene 5-oxide is sourced from PubChem (CID 102526913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).