About 2,8-dimethylphenoxathiine 10-oxide
2,8-dimethylphenoxathiine 10-oxide (PubChem CID 139056216) has the molecular formula C28H24O4S2
and a molecular weight of 488.63 g/mol. Its IUPAC name is 2,8-dimethylphenoxathiine 10-oxide.
Molecular Properties
| Compound Name | 2,8-dimethylphenoxathiine 10-oxide |
| PubChem CID | 139056216 |
| Molecular Formula | C28H24O4S2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 2,8-dimethylphenoxathiine 10-oxide |
| SMILES | Cc1ccc2c(c1)S(=O)c1cc(C)ccc1O2.Cc1ccc2c(c1)S(=O)c1cc(C)ccc1O2 |
| InChI | InChI=1S/2C14H12O2S/c2*1-9-3-5-11-13(7-9)17(15)14-8-10(2)4-6-12(14)16-11/h2*3-8H,1-2H3 |
| InChIKey | OKIKGOFPVPLEGS-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,8-dimethylphenoxathiine 10-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-dimethylphenoxathiine 10-oxide?
The IUPAC name of 2,8-dimethylphenoxathiine 10-oxide (CID 139056216) is 2,8-dimethylphenoxathiine 10-oxide.
What is the SMILES notation for 2,8-dimethylphenoxathiine 10-oxide?
The canonical SMILES for 2,8-dimethylphenoxathiine 10-oxide is Cc1ccc2c(c1)S(=O)c1cc(C)ccc1O2.Cc1ccc2c(c1)S(=O)c1cc(C)ccc1O2.
What is the InChIKey of 2,8-dimethylphenoxathiine 10-oxide?
The InChIKey is OKIKGOFPVPLEGS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H12O2S/c2*1-9-3-5-11-13(7-9)17(15)14-8-10(2)4-6-12(14)16-11/h2*3-8H,1-2H3.
What are the key properties of 2,8-dimethylphenoxathiine 10-oxide?
2,8-dimethylphenoxathiine 10-oxide has a molecular weight of 488.63 g/mol, XLogP of 7.15, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dimethylphenoxathiine 10-oxide is sourced from PubChem (CID 139056216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).