C14H12OS2 — CID 142700843
2,7-dimethylthianthrene 5-oxide (PubChem CID 142700843) has the molecular formula C14H12OS2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 2,7-dimethylthianthrene 5-oxide.
| Compound Name | 2,7-dimethylthianthrene 5-oxide |
|---|---|
| PubChem CID | 142700843 |
| Molecular Formula | C14H12OS2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 2,7-dimethylthianthrene 5-oxide |
| SMILES | Cc1ccc2c(c1)Sc1ccc(C)cc1S2=O |
| InChI | InChI=1S/C14H12OS2/c1-9-4-6-13-12(7-9)16-11-5-3-10(2)8-14(11)17(13)15/h3-8H,1-2H3 |
| InChIKey | LLROILIXZBBBCQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |