About 5-methylbenzotrioxole
5-methylbenzotrioxole (PubChem CID 147997120) has the molecular formula C7H6O3
and a molecular weight of 138.12 g/mol. Its IUPAC name is 5-methylbenzotrioxole.
Molecular Properties
| Compound Name | 5-methylbenzotrioxole |
| PubChem CID | 147997120 |
| Molecular Formula | C7H6O3 |
| Molecular Weight | 138.12 g/mol |
| Exact Mass | 138.03 |
| IUPAC Name | 5-methylbenzotrioxole |
| SMILES | Cc1ccc2c(c1)OOO2 |
| InChI | InChI=1S/C7H6O3/c1-5-2-3-6-7(4-5)9-10-8-6/h2-4H,1H3 |
| InChIKey | IWFQNNZCFVSSLJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.12 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 5-methylbenzotrioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylbenzotrioxole?
The IUPAC name of 5-methylbenzotrioxole (CID 147997120) is 5-methylbenzotrioxole.
What is the SMILES notation for 5-methylbenzotrioxole?
The canonical SMILES for 5-methylbenzotrioxole is Cc1ccc2c(c1)OOO2.
What is the InChIKey of 5-methylbenzotrioxole?
The InChIKey is IWFQNNZCFVSSLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3/c1-5-2-3-6-7(4-5)9-10-8-6/h2-4H,1H3.
What are the key properties of 5-methylbenzotrioxole?
5-methylbenzotrioxole has a molecular weight of 138.12 g/mol, XLogP of 1.61, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylbenzotrioxole is sourced from PubChem (CID 147997120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).