C20H16 — CID 132501429
7,12-dimethylpleiadene (PubChem CID 132501429) has the molecular formula C20H16 and a molecular weight of 256.35 g/mol. Its IUPAC name is 7,12-dimethylpleiadene.
| Compound Name | 7,12-dimethylpleiadene |
|---|---|
| PubChem CID | 132501429 |
| Molecular Formula | C20H16 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 7,12-dimethylpleiadene |
| SMILES | CC1=c2ccccc2=C(C)c2cccc3cccc1c23 |
| InChI | InChI=1S/C20H16/c1-13-16-9-3-4-10-17(16)14(2)19-12-6-8-15-7-5-11-18(13)20(15)19/h3-12H,1-2H3 |
| InChIKey | ZBEUEXWJZUWEQK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |