C16H12N2 — CID 42638865
11,14-dimethyl-12,13-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene (PubChem CID 42638865) has the molecular formula C16H12N2 and a molecular weight of 232.29 g/mol. Its IUPAC name is 11,14-dimethyl-12,13-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene.
| Compound Name | 11,14-dimethyl-12,13-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene |
|---|---|
| PubChem CID | 42638865 |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 11,14-dimethyl-12,13-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10,12,14-octaene |
| SMILES | Cc1nnc(C)c2c1-c1cccc3cccc-2c13 |
| InChI | InChI=1S/C16H12N2/c1-9-14-12-7-3-5-11-6-4-8-13(16(11)12)15(14)10(2)18-17-9/h3-8H,1-2H3 |
| InChIKey | HFRPQHGHJNPNEL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_65_Da(2)', 'substructure': 'N/A'} |
|---|