C29H23NSi — CID 102597671
trimethyl-(16-methyl-15-azaheptacyclo[15.6.2.13,7.02,12.014,24.021,25.011,26]hexacosa-1(24),2(12),3,5,7(26),8,10,13,15,17,19,21(25),22-tridecaen-13-yl)silane (PubChem CID 102597671) has the molecular formula C29H23NSi and a molecular weight of 413.60 g/mol. Its IUPAC name is trimethyl-(16-methyl-15-azaheptacyclo[15.6.2.13,7.02,12.014,24.021,25.011,26]hexacosa-1(24),2(12),3,5,7(26),8,10,13,15,17,19,21(25),22-tridecaen-13-yl)silane.
| Compound Name | trimethyl-(16-methyl-15-azaheptacyclo[15.6.2.13,7.02,12.014,24.021,25.011,26]hexacosa-1(24),2(12),3,5,7(26),8,10,13,15,17,19,21(25),22-tridecaen-13-yl)silane |
|---|---|
| PubChem CID | 102597671 |
| Molecular Formula | C29H23NSi |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | trimethyl-(16-methyl-15-azaheptacyclo[15.6.2.13,7.02,12.014,24.021,25.011,26]hexacosa-1(24),2(12),3,5,7(26),8,10,13,15,17,19,21(25),22-tridecaen-13-yl)silane |
| SMILES | Cc1nc2c([Si](C)(C)C)c3c(c4ccc5cccc1c5c42)-c1cccc2cccc-3c12 |
| InChI | InChI=1S/C29H23NSi/c1-16-19-11-5-10-18-14-15-22-25-20-12-6-8-17-9-7-13-21(23(17)20)27(25)29(31(2,3)4)28(30-16)26(22)24(18)19/h5-15H,1-4H3 |
| InChIKey | HNFWNPXTVRMXSK-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|