C17H13N — CID 86153815
6,7-dimethyl-5-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaene (PubChem CID 86153815) has the molecular formula C17H13N and a molecular weight of 231.30 g/mol. Its IUPAC name is 6,7-dimethyl-5-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaene.
| Compound Name | 6,7-dimethyl-5-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaene |
|---|---|
| PubChem CID | 86153815 |
| Molecular Formula | C17H13N |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 6,7-dimethyl-5-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaene |
| SMILES | Cc1nc2ccc3cccc4ccc(c1C)c2c34 |
| InChI | InChI=1S/C17H13N/c1-10-11(2)18-15-9-7-13-5-3-4-12-6-8-14(10)17(15)16(12)13/h3-9H,1-2H3 |
| InChIKey | HFHOQHIOTCYVDZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|